C15H9ClF3N3O2 — CID 118101446
methyl 2-chloro-6-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]pyridine-4-carboxylate (PubChem CID 118101446) has the molecular formula C15H9ClF3N3O2 and a molecular weight of 355.70 g/mol. Its IUPAC name is methyl 2-chloro-6-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-chloro-6-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118101446 |
| Molecular Formula | C15H9ClF3N3O2 |
| Molecular Weight | 355.70 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | methyl 2-chloro-6-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc(-c2c(C(F)(F)F)nc3ccccn23)c1 |
| InChI | InChI=1S/C15H9ClF3N3O2/c1-24-14(23)8-6-9(20-10(16)7-8)12-13(15(17,18)19)21-11-4-2-3-5-22(11)12/h2-7H,1H3 |
| InChIKey | DMTRFGDSTUCRGM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|