C19H14F3N5 — CID 118101485
N-[4-(difluoromethyl)-3-fluorophenyl]-6-(2-methylbenzimidazol-1-yl)pyrazin-2-amine (PubChem CID 118101485) has the molecular formula C19H14F3N5 and a molecular weight of 369.35 g/mol. Its IUPAC name is N-[4-(difluoromethyl)-3-fluorophenyl]-6-(2-methylbenzimidazol-1-yl)pyrazin-2-amine.
| Compound Name | N-[4-(difluoromethyl)-3-fluorophenyl]-6-(2-methylbenzimidazol-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 118101485 |
| Molecular Formula | C19H14F3N5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[4-(difluoromethyl)-3-fluorophenyl]-6-(2-methylbenzimidazol-1-yl)pyrazin-2-amine |
| SMILES | Cc1nc2ccccc2n1-c1cncc(Nc2ccc(C(F)F)c(F)c2)n1 |
| InChI | InChI=1S/C19H14F3N5/c1-11-24-15-4-2-3-5-16(15)27(11)18-10-23-9-17(26-18)25-12-6-7-13(19(21)22)14(20)8-12/h2-10,19H,1H3,(H,25,26) |
| InChIKey | PXLWBCZPVLKXPI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |