C19H16FN5 — CID 118094337
6-(6-fluoro-2-methylbenzimidazol-1-yl)-N-(3-methylphenyl)pyrazin-2-amine (PubChem CID 118094337) has the molecular formula C19H16FN5 and a molecular weight of 333.37 g/mol. Its IUPAC name is 6-(6-fluoro-2-methylbenzimidazol-1-yl)-N-(3-methylphenyl)pyrazin-2-amine.
| Compound Name | 6-(6-fluoro-2-methylbenzimidazol-1-yl)-N-(3-methylphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 118094337 |
| Molecular Formula | C19H16FN5 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 6-(6-fluoro-2-methylbenzimidazol-1-yl)-N-(3-methylphenyl)pyrazin-2-amine |
| SMILES | Cc1cccc(Nc2cncc(-n3c(C)nc4ccc(F)cc43)n2)c1 |
| InChI | InChI=1S/C19H16FN5/c1-12-4-3-5-15(8-12)23-18-10-21-11-19(24-18)25-13(2)22-16-7-6-14(20)9-17(16)25/h3-11H,1-2H3,(H,23,24) |
| InChIKey | CZRAYDNVDFEKDH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |