C20H16F3N5O — CID 118095066
6-(6-methoxy-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (PubChem CID 118095066) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is 6-(6-methoxy-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine.
| Compound Name | 6-(6-methoxy-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 118095066 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 6-(6-methoxy-2-methylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| SMILES | COc1ccc2nc(C)n(-c3cncc(Nc4ccc(C(F)(F)F)cc4)n3)c2c1 |
| InChI | InChI=1S/C20H16F3N5O/c1-12-25-16-8-7-15(29-2)9-17(16)28(12)19-11-24-10-18(27-19)26-14-5-3-13(4-6-14)20(21,22)23/h3-11H,1-2H3,(H,26,27) |
| InChIKey | QVJPTKCWNHFLLJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |