C19H15F3N6 — CID 118094951
N-methyl-1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-amine (PubChem CID 118094951) has the molecular formula C19H15F3N6 and a molecular weight of 384.37 g/mol. Its IUPAC name is N-methyl-1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-amine.
| Compound Name | N-methyl-1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 118094951 |
| Molecular Formula | C19H15F3N6 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-methyl-1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-amine |
| SMILES | CNc1nc2ccccc2n1-c1cncc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C19H15F3N6/c1-23-18-26-14-4-2-3-5-15(14)28(18)17-11-24-10-16(27-17)25-13-8-6-12(7-9-13)19(20,21)22/h2-11H,1H3,(H,23,26)(H,25,27) |
| InChIKey | SFHFMSRFDWLDRC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |