C22H18F3N5O2 — CID 118101400
[(1S)-1-[1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-yl]ethyl] acetate (PubChem CID 118101400) has the molecular formula C22H18F3N5O2 and a molecular weight of 441.41 g/mol. Its IUPAC name is [(1S)-1-[1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 118101400 |
| Molecular Formula | C22H18F3N5O2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [(1S)-1-[1-[6-[4-(trifluoromethyl)anilino]pyrazin-2-yl]benzimidazol-2-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)c1nc2ccccc2n1-c1cncc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C22H18F3N5O2/c1-13(32-14(2)31)21-28-17-5-3-4-6-18(17)30(21)20-12-26-11-19(29-20)27-16-9-7-15(8-10-16)22(23,24)25/h3-13H,1-2H3,(H,27,29)/t13-/m0/s1 |
| InChIKey | KGHRQIWDTHIIGE-ZDUSSCGKSA-N |
| XLogP | 5.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |