C20H16F3N5S — CID 118095114
6-(2-ethylsulfanylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (PubChem CID 118095114) has the molecular formula C20H16F3N5S and a molecular weight of 415.44 g/mol. Its IUPAC name is 6-(2-ethylsulfanylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine.
| Compound Name | 6-(2-ethylsulfanylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 118095114 |
| Molecular Formula | C20H16F3N5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 6-(2-ethylsulfanylbenzimidazol-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| SMILES | CCSc1nc2ccccc2n1-c1cncc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H16F3N5S/c1-2-29-19-26-15-5-3-4-6-16(15)28(19)18-12-24-11-17(27-18)25-14-9-7-13(8-10-14)20(21,22)23/h3-12H,2H2,1H3,(H,25,27) |
| InChIKey | AKQZHGNXZKFNPW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |