C21H25BrN4O4 — CID 118101847
tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 118101847) has the molecular formula C21H25BrN4O4 and a molecular weight of 477.36 g/mol. Its IUPAC name is tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 118101847 |
| Molecular Formula | C21H25BrN4O4 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(Nc1c([N+](=O)[O-])cnc3ccc(Br)cc13)C2 |
| InChI | InChI=1S/C21H25BrN4O4/c1-21(2,3)30-20(27)25-14-5-6-15(25)10-13(9-14)24-19-16-8-12(22)4-7-17(16)23-11-18(19)26(28)29/h4,7-8,11,13-15H,5-6,9-10H2,1-3H3,(H,23,24) |
| InChIKey | OSOSQKICTLHZGU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|