C24H39FN2 — CID 118102478
4-[2-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)phenyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 118102478) has the molecular formula C24H39FN2 and a molecular weight of 374.59 g/mol. Its IUPAC name is 4-[2-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)phenyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[2-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)phenyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 118102478 |
| Molecular Formula | C24H39FN2 |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 4-[2-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)phenyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(c2ccc(C3CC(C)(C)NC(C)(C)C3)c(F)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H39FN2/c1-21(2)12-17(13-22(3,4)26-21)16-9-10-19(20(25)11-16)18-14-23(5,6)27-24(7,8)15-18/h9-11,17-18,26-27H,12-15H2,1-8H3 |
| InChIKey | JDYMIKZQGOEFQH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |