C27H27Cl2F3INO4 — CID 118102572
2-iodopropan-2-yl 1-[[4-chloro-3-[[(2S,3R)-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-ethenoxymethyl]cyclopropane-1-carboxylate (PubChem CID 118102572) has the molecular formula C27H27Cl2F3INO4 and a molecular weight of 684.32 g/mol. Its IUPAC name is 2-iodopropan-2-yl 1-[[4-chloro-3-[[(2S,3R)-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-ethenoxymethyl]cyclopropane-1-carboxylate.
| Compound Name | 2-iodopropan-2-yl 1-[[4-chloro-3-[[(2S,3R)-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-ethenoxymethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118102572 |
| Molecular Formula | C27H27Cl2F3INO4 |
| Molecular Weight | 684.32 g/mol |
| Exact Mass | 683.03 |
| IUPAC Name | 2-iodopropan-2-yl 1-[[4-chloro-3-[[(2S,3R)-2-(4-chlorophenyl)-4,4,4-trifluoro-3-methylbutanoyl]amino]phenyl]-ethenoxymethyl]cyclopropane-1-carboxylate |
| SMILES | C=COC(c1ccc(Cl)c(NC(=O)[C@H](c2ccc(Cl)cc2)[C@@H](C)C(F)(F)F)c1)C1(C(=O)OC(C)(C)I)CC1 |
| InChI | InChI=1S/C27H27Cl2F3INO4/c1-5-37-22(26(12-13-26)24(36)38-25(3,4)33)17-8-11-19(29)20(14-17)34-23(35)21(15(2)27(30,31)32)16-6-9-18(28)10-7-16/h5-11,14-15,21-22H,1,12-13H2,2-4H3,(H,34,35)/t15-,21+,22?/m1/s1 |
| InChIKey | AIXCXWHHPXMMPZ-XLRMLUQGSA-N |
| XLogP | 8.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.32 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|