C23H24Cl2N4O6S2 — CID 118102943
4-[[4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-3-methyl-1,1-dioxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 118102943) has the molecular formula C23H24Cl2N4O6S2 and a molecular weight of 587.51 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-3-methyl-1,1-dioxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 4-[[4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-3-methyl-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 118102943 |
| Molecular Formula | C23H24Cl2N4O6S2 |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | 4-[[4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-3-methyl-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | CCOC(=O)C1=C(CN2CCS(=O)(=O)CC2(C)C(=O)O)NC(c2nccs2)=NC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H24Cl2N4O6S2/c1-3-35-21(30)17-16(11-29-7-9-37(33,34)12-23(29,2)22(31)32)27-19(20-26-6-8-36-20)28-18(17)14-5-4-13(24)10-15(14)25/h4-6,8,10,18H,3,7,9,11-12H2,1-2H3,(H,27,28)(H,31,32) |
| InChIKey | IDIQGWHLHXVKDV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |