C28H25ClN4O6 — CID 118105967
tert-butyl N-[4-chloro-2-[3-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate (PubChem CID 118105967) has the molecular formula C28H25ClN4O6 and a molecular weight of 548.98 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-2-[3-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-2-[3-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 118105967 |
| Molecular Formula | C28H25ClN4O6 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | tert-butyl N-[4-chloro-2-[3-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1-c1cc2n(c(=O)c1)C(c1cc(-c3ccc([N+](=O)[O-])cc3)no1)CC2 |
| InChI | InChI=1S/C28H25ClN4O6/c1-28(2,3)38-27(35)30-22-10-6-18(29)14-21(22)17-12-20-9-11-24(32(20)26(34)13-17)25-15-23(31-39-25)16-4-7-19(8-5-16)33(36)37/h4-8,10,12-15,24H,9,11H2,1-3H3,(H,30,35) |
| InChIKey | LIKFXJUHPZPMLR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|