C29H26ClN5O6 — CID 118106300
tert-butyl N-[4-chloro-2-[3-[5-(4-nitrophenyl)-6-oxo-1H-pyridazin-3-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate (PubChem CID 118106300) has the molecular formula C29H26ClN5O6 and a molecular weight of 576.01 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-2-[3-[5-(4-nitrophenyl)-6-oxo-1H-pyridazin-3-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-2-[3-[5-(4-nitrophenyl)-6-oxo-1H-pyridazin-3-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 118106300 |
| Molecular Formula | C29H26ClN5O6 |
| Molecular Weight | 576.01 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | tert-butyl N-[4-chloro-2-[3-[5-(4-nitrophenyl)-6-oxo-1H-pyridazin-3-yl]-5-oxo-2,3-dihydro-1H-indolizin-7-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1-c1cc2n(c(=O)c1)C(c1cc(-c3ccc([N+](=O)[O-])cc3)c(=O)[nH]n1)CC2 |
| InChI | InChI=1S/C29H26ClN5O6/c1-29(2,3)41-28(38)31-23-10-6-18(30)14-21(23)17-12-20-9-11-25(34(20)26(36)13-17)24-15-22(27(37)33-32-24)16-4-7-19(8-5-16)35(39)40/h4-8,10,12-15,25H,9,11H2,1-3H3,(H,31,38)(H,33,37) |
| InChIKey | LKMDNKZYMZRMMR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 149.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.01 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|