C11H11F3O5S — CID 118106737
(2R)-3-phenyl-2-(trifluoromethylsulfonyloxy)butanoic acid (PubChem CID 118106737) has the molecular formula C11H11F3O5S and a molecular weight of 312.27 g/mol. Its IUPAC name is (2R)-3-phenyl-2-(trifluoromethylsulfonyloxy)butanoic acid.
| Compound Name | (2R)-3-phenyl-2-(trifluoromethylsulfonyloxy)butanoic acid |
|---|---|
| PubChem CID | 118106737 |
| Molecular Formula | C11H11F3O5S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (2R)-3-phenyl-2-(trifluoromethylsulfonyloxy)butanoic acid |
| SMILES | CC(c1ccccc1)[C@@H](OS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H11F3O5S/c1-7(8-5-3-2-4-6-8)9(10(15)16)19-20(17,18)11(12,13)14/h2-7,9H,1H3,(H,15,16)/t7?,9-/m1/s1 |
| InChIKey | DJFKYKGRPZWEEP-NHSZFOGYSA-N |
| XLogP | 2.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|