C14H16F3NO3S — CID 130217154
[(1S)-2-[methyl(prop-2-ynyl)amino]-1-phenylpropyl] trifluoromethanesulfonate (PubChem CID 130217154) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is [(1S)-2-[methyl(prop-2-ynyl)amino]-1-phenylpropyl] trifluoromethanesulfonate.
| Compound Name | [(1S)-2-[methyl(prop-2-ynyl)amino]-1-phenylpropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130217154 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [(1S)-2-[methyl(prop-2-ynyl)amino]-1-phenylpropyl] trifluoromethanesulfonate |
| SMILES | C#CCN(C)C(C)[C@@H](OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H16F3NO3S/c1-4-10-18(3)11(2)13(12-8-6-5-7-9-12)21-22(19,20)14(15,16)17/h1,5-9,11,13H,10H2,2-3H3/t11?,13-/m1/s1 |
| InChIKey | HKFZJTTXPRXWDE-GLGOKHISSA-N |
| XLogP | 2.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|