C17H21NO3 — CID 88560529
(Z)-3-ethoxy-5-[methyl(prop-2-ynyl)amino]-5-phenylpent-2-enoic acid (PubChem CID 88560529) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (Z)-3-ethoxy-5-[methyl(prop-2-ynyl)amino]-5-phenylpent-2-enoic acid.
| Compound Name | (Z)-3-ethoxy-5-[methyl(prop-2-ynyl)amino]-5-phenylpent-2-enoic acid |
|---|---|
| PubChem CID | 88560529 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (Z)-3-ethoxy-5-[methyl(prop-2-ynyl)amino]-5-phenylpent-2-enoic acid |
| SMILES | C#CCN(C)C(C/C(=C/C(=O)O)OCC)c1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-4-11-18(3)16(14-9-7-6-8-10-14)12-15(21-5-2)13-17(19)20/h1,6-10,13,16H,5,11-12H2,2-3H3,(H,19,20)/b15-13- |
| InChIKey | GSHKEEWMCALYBB-SQFISAMPSA-N |
| XLogP | 2.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|