C22H18ClF2N3O2 — CID 118108486
6-(6-chloro-3-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-(methoxymethyl)benzimidazole (PubChem CID 118108486) has the molecular formula C22H18ClF2N3O2 and a molecular weight of 429.85 g/mol. Its IUPAC name is 6-(6-chloro-3-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-(methoxymethyl)benzimidazole.
| Compound Name | 6-(6-chloro-3-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-(methoxymethyl)benzimidazole |
|---|---|
| PubChem CID | 118108486 |
| Molecular Formula | C22H18ClF2N3O2 |
| Molecular Weight | 429.85 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 6-(6-chloro-3-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-(methoxymethyl)benzimidazole |
| SMILES | COCc1nc2ccc(-c3ccc(Cl)nc3)cc2n1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C22H18ClF2N3O2/c1-29-13-21-27-17-8-6-14(15-7-9-20(23)26-11-15)10-18(17)28(21)12-16-4-2-3-5-19(16)30-22(24)25/h2-11,22H,12-13H2,1H3 |
| InChIKey | MKEMVFAGXCPXRW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|