C21H15Cl2F2N3O2 — CID 122620371
6-(2,5-dichloro-4-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-methylindazol-3-one (PubChem CID 122620371) has the molecular formula C21H15Cl2F2N3O2 and a molecular weight of 450.27 g/mol. Its IUPAC name is 6-(2,5-dichloro-4-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-methylindazol-3-one.
| Compound Name | 6-(2,5-dichloro-4-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-methylindazol-3-one |
|---|---|
| PubChem CID | 122620371 |
| Molecular Formula | C21H15Cl2F2N3O2 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 6-(2,5-dichloro-4-pyridinyl)-1-[[2-(difluoromethoxy)phenyl]methyl]-2-methylindazol-3-one |
| SMILES | Cn1c(=O)c2ccc(-c3cc(Cl)ncc3Cl)cc2n1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C21H15Cl2F2N3O2/c1-27-20(29)14-7-6-12(15-9-19(23)26-10-16(15)22)8-17(14)28(27)11-13-4-2-3-5-18(13)30-21(24)25/h2-10,21H,11H2,1H3 |
| InChIKey | DQYWBAMGWBZXNH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|