C15H11ClF3N3O2 — CID 154488767
6-chloro-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylpyrazolo[3,4-b]pyridin-3-one (PubChem CID 154488767) has the molecular formula C15H11ClF3N3O2 and a molecular weight of 357.72 g/mol. Its IUPAC name is 6-chloro-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylpyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-chloro-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylpyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 154488767 |
| Molecular Formula | C15H11ClF3N3O2 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 6-chloro-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylpyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cn1c(=O)c2cc(F)c(Cl)nc2n1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H11ClF3N3O2/c1-21-14(23)9-6-10(17)12(16)20-13(9)22(21)7-8-4-2-3-5-11(8)24-15(18)19/h2-6,15H,7H2,1H3 |
| InChIKey | CHSBBUQFUAZFCB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|