C24H19Br2F5N4O3 — CID 160963935
6-bromo-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylindazol-3-one;4-bromo-2,5-difluoro-N-methylbenzohydrazide (PubChem CID 160963935) has the molecular formula C24H19Br2F5N4O3 and a molecular weight of 666.24 g/mol. Its IUPAC name is 6-bromo-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylindazol-3-one;4-bromo-2,5-difluoro-N-methylbenzohydrazide.
| Compound Name | 6-bromo-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylindazol-3-one;4-bromo-2,5-difluoro-N-methylbenzohydrazide |
|---|---|
| PubChem CID | 160963935 |
| Molecular Formula | C24H19Br2F5N4O3 |
| Molecular Weight | 666.24 g/mol |
| Exact Mass | 663.97 |
| IUPAC Name | 6-bromo-1-[[2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylindazol-3-one;4-bromo-2,5-difluoro-N-methylbenzohydrazide |
| SMILES | CN(N)C(=O)c1cc(F)c(Br)cc1F.Cn1c(=O)c2cc(F)c(Br)cc2n1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H12BrF3N2O2.C8H7BrF2N2O/c1-21-15(23)10-6-12(18)11(17)7-13(10)22(21)8-9-4-2-3-5-14(9)24-16(19)20;1-13(12)8(14)4-2-7(11)5(9)3-6(4)10/h2-7,16H,8H2,1H3;2-3H,12H2,1H3 |
| InChIKey | SXJFTZOPKCRBMF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.24 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|