C10H14N2O2 — CID 118110284
4-pyrrol-1-ylpiperidine-1-carboxylic acid (PubChem CID 118110284) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-pyrrol-1-ylpiperidine-1-carboxylic acid.
| Compound Name | 4-pyrrol-1-ylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118110284 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-pyrrol-1-ylpiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(n2cccc2)CC1 |
| InChI | InChI=1S/C10H14N2O2/c13-10(14)12-7-3-9(4-8-12)11-5-1-2-6-11/h1-2,5-6,9H,3-4,7-8H2,(H,13,14) |
| InChIKey | MBQRBKXPCXABGR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |