C21H23NO6 — CID 11811109
(5S,13aS)-5-hydroxy-2,3,10,11-tetramethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 11811109) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (5S,13aS)-5-hydroxy-2,3,10,11-tetramethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | (5S,13aS)-5-hydroxy-2,3,10,11-tetramethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 11811109 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (5S,13aS)-5-hydroxy-2,3,10,11-tetramethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N1C[C@@H](O)c3cc(OC)c(OC)cc3[C@@H]1C2 |
| InChI | InChI=1S/C21H23NO6/c1-25-17-6-11-5-15-13-8-19(27-3)20(28-4)9-14(13)16(23)10-22(15)21(24)12(11)7-18(17)26-2/h6-9,15-16,23H,5,10H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | JDVYYRBSYZRYAU-JKSUJKDBSA-N |
| XLogP | 2.51 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |