About 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea
1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea (PubChem CID 118114934) has the molecular formula C14H19ClN6O
and a molecular weight of 322.80 g/mol. Its IUPAC name is 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea |
| PubChem CID | 118114934 |
| Molecular Formula | C14H19ClN6O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)C1CCCN(c2cnc(C#N)c(Cl)n2)C1 |
| InChI | InChI=1S/C14H19ClN6O/c1-19(2)14(22)20(3)10-5-4-6-21(9-10)12-8-17-11(7-16)13(15)18-12/h8,10H,4-6,9H2,1-3H3 |
| InChIKey | DUZDGZLAMZYSLL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea?
The IUPAC name of 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea (CID 118114934) is 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea is CN(C)C(=O)N(C)C1CCCN(c2cnc(C#N)c(Cl)n2)C1.
What is the InChIKey of 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea?
The InChIKey is DUZDGZLAMZYSLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN6O/c1-19(2)14(22)20(3)10-5-4-6-21(9-10)12-8-17-11(7-16)13(15)18-12/h8,10H,4-6,9H2,1-3H3.
What are the key properties of 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea?
1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea has a molecular weight of 322.80 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(6-chloro-5-cyanopyrazin-2-yl)piperidin-3-yl]-1,3,3-trimethylurea is sourced from PubChem (CID 118114934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).