C19H34ClN5O2 — CID 144858058
tert-butyl carbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane (PubChem CID 144858058) has the molecular formula C19H34ClN5O2 and a molecular weight of 399.97 g/mol. Its IUPAC name is tert-butyl carbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane.
| Compound Name | tert-butyl carbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 144858058 |
| Molecular Formula | C19H34ClN5O2 |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | tert-butyl carbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane |
| SMILES | CC.CC.CC(C)(C)OC(N)=O.N#Cc1ncc(N2CCCCC2)nc1Cl |
| InChI | InChI=1S/C10H11ClN4.C5H11NO2.2C2H6/c11-10-8(6-12)13-7-9(14-10)15-4-2-1-3-5-15;1-5(2,3)8-4(6)7;2*1-2/h7H,1-5H2;1-3H3,(H2,6,7);2*1-2H3 |
| InChIKey | YGOBHXWNHNFMEM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |