C20H26ClN5O2 — CID 144858072
3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane;4-methoxybenzamide (PubChem CID 144858072) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane;4-methoxybenzamide.
| Compound Name | 3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane;4-methoxybenzamide |
|---|---|
| PubChem CID | 144858072 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane;4-methoxybenzamide |
| SMILES | CC.COc1ccc(C(N)=O)cc1.N#Cc1ncc(N2CCCCC2)nc1Cl |
| InChI | InChI=1S/C10H11ClN4.C8H9NO2.C2H6/c11-10-8(6-12)13-7-9(14-10)15-4-2-1-3-5-15;1-11-7-4-2-6(3-5-7)8(9)10;1-2/h7H,1-5H2;2-5H,1H3,(H2,9,10);1-2H3 |
| InChIKey | IKDHOUNTEBEIDE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |