C18H30ClN5O2 — CID 144858007
tert-butyl N-methylcarbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane (PubChem CID 144858007) has the molecular formula C18H30ClN5O2 and a molecular weight of 383.92 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane.
| Compound Name | tert-butyl N-methylcarbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 144858007 |
| Molecular Formula | C18H30ClN5O2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl N-methylcarbamate;3-chloro-5-piperidin-1-ylpyrazine-2-carbonitrile;ethane |
| SMILES | CC.CNC(=O)OC(C)(C)C.N#Cc1ncc(N2CCCCC2)nc1Cl |
| InChI | InChI=1S/C10H11ClN4.C6H13NO2.C2H6/c11-10-8(6-12)13-7-9(14-10)15-4-2-1-3-5-15;1-6(2,3)9-5(8)7-4;1-2/h7H,1-5H2;1-4H3,(H,7,8);1-2H3 |
| InChIKey | WQWBNGFFJWWYRI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |