C22H23IN6O2 — CID 118114952
12-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-8-[(3-iodophenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 118114952) has the molecular formula C22H23IN6O2 and a molecular weight of 530.37 g/mol. Its IUPAC name is 12-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-8-[(3-iodophenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 12-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-8-[(3-iodophenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 118114952 |
| Molecular Formula | C22H23IN6O2 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 12-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-8-[(3-iodophenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | C[C@@H]1CN(Cc2cnc3c(c2)c2ncnn2c(=O)n3Cc2cccc(I)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C22H23IN6O2/c1-14-9-27(10-15(2)31-14)11-17-7-19-20(24-8-17)28(12-16-4-3-5-18(23)6-16)22(30)29-21(19)25-13-26-29/h3-8,13-15H,9-12H2,1-2H3/t14-,15+ |
| InChIKey | WUSQIEMTTSJENQ-GASCZTMLSA-N |
| XLogP | 2.70 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|