C22H24N6O3 — CID 118135069
8-[(4-methoxyphenyl)methyl]-12-[methyl(oxan-4-yl)amino]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 118135069) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)methyl]-12-[methyl(oxan-4-yl)amino]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 8-[(4-methoxyphenyl)methyl]-12-[methyl(oxan-4-yl)amino]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 118135069 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 8-[(4-methoxyphenyl)methyl]-12-[methyl(oxan-4-yl)amino]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3cc(N(C)C4CCOCC4)cnc32)cc1 |
| InChI | InChI=1S/C22H24N6O3/c1-26(16-7-9-31-10-8-16)17-11-19-20(23-12-17)27(22(29)28-21(19)24-14-25-28)13-15-3-5-18(30-2)6-4-15/h3-6,11-12,14,16H,7-10,13H2,1-2H3 |
| InChIKey | VRKOXSGQUARPTN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |