C19H16F3N5O5S — CID 118115349
[2,2,2-trifluoro-1-[8-[(4-methoxyphenyl)methyl]-7-oxo-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-12-yl]ethyl] methanesulfonate (PubChem CID 118115349) has the molecular formula C19H16F3N5O5S and a molecular weight of 483.43 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-[8-[(4-methoxyphenyl)methyl]-7-oxo-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-12-yl]ethyl] methanesulfonate.
| Compound Name | [2,2,2-trifluoro-1-[8-[(4-methoxyphenyl)methyl]-7-oxo-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-12-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 118115349 |
| Molecular Formula | C19H16F3N5O5S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | [2,2,2-trifluoro-1-[8-[(4-methoxyphenyl)methyl]-7-oxo-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-12-yl]ethyl] methanesulfonate |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3cc(C(OS(C)(=O)=O)C(F)(F)F)cnc32)cc1 |
| InChI | InChI=1S/C19H16F3N5O5S/c1-31-13-5-3-11(4-6-13)9-26-16-14(17-24-10-25-27(17)18(26)28)7-12(8-23-16)15(19(20,21)22)32-33(2,29)30/h3-8,10,15H,9H2,1-2H3 |
| InChIKey | JBNJNVHEGBGHAG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 117.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|