C24H28N6O2 — CID 118115683
12-[[cyclohexyl(methyl)amino]methyl]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 118115683) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 12-[[cyclohexyl(methyl)amino]methyl]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 12-[[cyclohexyl(methyl)amino]methyl]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 118115683 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 12-[[cyclohexyl(methyl)amino]methyl]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3cc(CN(C)C4CCCCC4)cnc32)cc1 |
| InChI | InChI=1S/C24H28N6O2/c1-28(19-6-4-3-5-7-19)14-18-12-21-22(25-13-18)29(24(31)30-23(21)26-16-27-30)15-17-8-10-20(32-2)11-9-17/h8-13,16,19H,3-7,14-15H2,1-2H3 |
| InChIKey | RSIWAONLJPNADZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |