C22H25N7O2 — CID 118115833
12-[[(1S,2S)-2-aminocyclohexyl]amino]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 118115833) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 12-[[(1S,2S)-2-aminocyclohexyl]amino]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 12-[[(1S,2S)-2-aminocyclohexyl]amino]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 118115833 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 12-[[(1S,2S)-2-aminocyclohexyl]amino]-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3cc(N[C@H]4CCCC[C@@H]4N)cnc32)cc1 |
| InChI | InChI=1S/C22H25N7O2/c1-31-16-8-6-14(7-9-16)12-28-20-17(21-25-13-26-29(21)22(28)30)10-15(11-24-20)27-19-5-3-2-4-18(19)23/h6-11,13,18-19,27H,2-5,12,23H2,1H3/t18-,19-/m0/s1 |
| InChIKey | IQXGHTMTUMPVTA-OALUTQOASA-N |
| XLogP | 2.18 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |