C17H16N6O2 — CID 138659664
11-(aminomethyl)-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 138659664) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 11-(aminomethyl)-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 11-(aminomethyl)-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 138659664 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 11-(aminomethyl)-8-[(4-methoxyphenyl)methyl]-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3ccc(CN)nc32)cc1 |
| InChI | InChI=1S/C17H16N6O2/c1-25-13-5-2-11(3-6-13)9-22-16-14(7-4-12(8-18)21-16)15-19-10-20-23(15)17(22)24/h2-7,10H,8-9,18H2,1H3 |
| InChIKey | GBTVVCBIBXMAOQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |