C16H19N5O — CID 118115469
1-[2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 118115469) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118115469 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-[2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C2CCC(Nc3ncnc4[nH]ccc34)C1CC2 |
| InChI | InChI=1S/C16H19N5O/c1-2-14(22)21-10-3-5-12(13(21)6-4-10)20-16-11-7-8-17-15(11)18-9-19-16/h2,7-10,12-13H,1,3-6H2,(H2,17,18,19,20) |
| InChIKey | QYIPJSZIRHLIPY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|