C17H21N5O3 — CID 122673999
[(1R)-1-[(2R,5S)-1-prop-2-enoyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-2-yl]ethyl] formate (PubChem CID 122673999) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is [(1R)-1-[(2R,5S)-1-prop-2-enoyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-2-yl]ethyl] formate.
| Compound Name | [(1R)-1-[(2R,5S)-1-prop-2-enoyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-2-yl]ethyl] formate |
|---|---|
| PubChem CID | 122673999 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(1R)-1-[(2R,5S)-1-prop-2-enoyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-2-yl]ethyl] formate |
| SMILES | C=CC(=O)N1C[C@@H](Nc2ncnc3[nH]ccc23)CC[C@@H]1[C@@H](C)OC=O |
| InChI | InChI=1S/C17H21N5O3/c1-3-15(24)22-8-12(4-5-14(22)11(2)25-10-23)21-17-13-6-7-18-16(13)19-9-20-17/h3,6-7,9-12,14H,1,4-5,8H2,2H3,(H2,18,19,20,21)/t11-,12+,14-/m1/s1 |
| InChIKey | HCJOCBZEASAQLZ-MBNYWOFBSA-N |
| XLogP | 1.48 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|