C23H30O7 — CID 11811824
[(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11811824) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11811824 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\CO)CC/C=C(\C)C[C@H](OC(=O)C(=C)[C@@H]3COC(C)(C)O3)[C@@H]12 |
| InChI | InChI=1S/C23H30O7/c1-13-7-6-8-16(11-24)10-18-20(15(3)22(26)29-18)17(9-13)28-21(25)14(2)19-12-27-23(4,5)30-19/h7,10,17-20,24H,2-3,6,8-9,11-12H2,1,4-5H3/b13-7+,16-10-/t17-,18+,19-,20+/m0/s1 |
| InChIKey | JPOJFQLMPJCIMP-SQMXKBNWSA-N |
| XLogP | 2.75 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|