C20H13F3O2 — CID 118119510
2-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 118119510) has the molecular formula C20H13F3O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118119510 |
| Molecular Formula | C20H13F3O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccc(C2=CC(=O)C(c3ccc(C(F)(F)F)cc3)=CC2=O)cc1 |
| InChI | InChI=1S/C20H13F3O2/c1-12-2-4-13(5-3-12)16-10-19(25)17(11-18(16)24)14-6-8-15(9-7-14)20(21,22)23/h2-11H,1H3 |
| InChIKey | KCRCNZWGAKDRJT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|