C23H28N3O5+ — CID 11811960
(Z,3S,4S)-2-hydroxy-4-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybut-1-ene-1-diazonium (PubChem CID 11811960) has the molecular formula C23H28N3O5+ and a molecular weight of 426.49 g/mol. Its IUPAC name is (Z,3S,4S)-2-hydroxy-4-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybut-1-ene-1-diazonium.
| Compound Name | (Z,3S,4S)-2-hydroxy-4-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybut-1-ene-1-diazonium |
|---|---|
| PubChem CID | 11811960 |
| Molecular Formula | C23H28N3O5+ |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (Z,3S,4S)-2-hydroxy-4-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybut-1-ene-1-diazonium |
| SMILES | COc1ccc([C@H](NC(=O)OC(C)(C)C)[C@H](OCc2ccccc2)/C(O)=C/[N+]#N)cc1 |
| InChI | InChI=1S/C23H27N3O5/c1-23(2,3)31-22(28)26-20(17-10-12-18(29-4)13-11-17)21(19(27)14-25-24)30-15-16-8-6-5-7-9-16/h5-14,20-21H,15H2,1-4H3,(H-,26,27,28)/p+1/b19-14-/t20-,21+/m0/s1 |
| InChIKey | APQXTBZAMSADSU-FRNKDNLASA-O |
| XLogP | 5.10 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|