C24H32N4O6 — CID 44612834
tert-butyl N-[(2S,3S,4R)-4-azido-5-hydroxy-1-(4-methoxyphenoxy)-3-phenylmethoxypentan-2-yl]carbamate (PubChem CID 44612834) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4R)-4-azido-5-hydroxy-1-(4-methoxyphenoxy)-3-phenylmethoxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4R)-4-azido-5-hydroxy-1-(4-methoxyphenoxy)-3-phenylmethoxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 44612834 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl N-[(2S,3S,4R)-4-azido-5-hydroxy-1-(4-methoxyphenoxy)-3-phenylmethoxypentan-2-yl]carbamate |
| SMILES | COc1ccc(OC[C@H](NC(=O)OC(C)(C)C)[C@H](OCc2ccccc2)[C@@H](CO)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C24H32N4O6/c1-24(2,3)34-23(30)26-21(16-32-19-12-10-18(31-4)11-13-19)22(20(14-29)27-28-25)33-15-17-8-6-5-7-9-17/h5-13,20-22,29H,14-16H2,1-4H3,(H,26,30)/t20-,21+,22-/m1/s1 |
| InChIKey | JNWAFBBUNCWSQD-BHIFYINESA-N |
| XLogP | 4.22 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|