C67H100O6 — CID 118120796
4-[4-[2-[4-[2-hydroxy-3-[3-[(E)-pentadec-10-enyl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]hexan-2-ol (PubChem CID 118120796) has the molecular formula C67H100O6 and a molecular weight of 1001.53 g/mol. Its IUPAC name is 4-[4-[2-[4-[2-hydroxy-3-[3-[(E)-pentadec-10-enyl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]hexan-2-ol.
| Compound Name | 4-[4-[2-[4-[2-hydroxy-3-[3-[(E)-pentadec-10-enyl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]hexan-2-ol |
|---|---|
| PubChem CID | 118120796 |
| Molecular Formula | C67H100O6 |
| Molecular Weight | 1001.53 g/mol |
| Exact Mass | 1000.75 |
| IUPAC Name | 4-[4-[2-[4-[2-hydroxy-3-[3-[(E)-pentadec-10-enyl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]hexan-2-ol |
| SMILES | CCCC/C=C/CCCCCCCCCc1cccc(OCC(O)COc2ccc(C(C)(C)c3ccc(OC(C)(CC)CC(O)COc4cccc(CCCCCCCCC/C=C/CCCC)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C67H100O6/c1-7-10-12-14-16-18-20-22-24-26-28-30-32-36-56-38-34-40-64(50-56)71-53-60(68)52-67(6,9-3)73-63-48-44-59(45-49-63)66(4,5)58-42-46-62(47-43-58)70-54-61(69)55-72-65-41-35-39-57(51-65)37-33-31-29-27-25-23-21-19-17-15-13-11-8-2/h14-17,34-35,38-51,60-61,68-69H,7-13,18-33,36-37,52-55H2,1-6H3/b16-14+,17-15+ |
| InChIKey | MOUYUDYDZYGBDG-YXLFCKQPSA-N |
| XLogP | 18.03 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.53 |
| LogP ≤ 5 | 18.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|