C55H78O6 — CID 126626098
4-[4-[2-[4-[2-(2-hydroxy-3-phenoxypropoxy)butan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]pentan-2-ol (PubChem CID 126626098) has the molecular formula C55H78O6 and a molecular weight of 835.22 g/mol. Its IUPAC name is 4-[4-[2-[4-[2-(2-hydroxy-3-phenoxypropoxy)butan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]pentan-2-ol.
| Compound Name | 4-[4-[2-[4-[2-(2-hydroxy-3-phenoxypropoxy)butan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]pentan-2-ol |
|---|---|
| PubChem CID | 126626098 |
| Molecular Formula | C55H78O6 |
| Molecular Weight | 835.22 g/mol |
| Exact Mass | 834.58 |
| IUPAC Name | 4-[4-[2-[4-[2-(2-hydroxy-3-phenoxypropoxy)butan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methyl-1-[3-[(E)-pentadec-10-enyl]phenoxy]pentan-2-ol |
| SMILES | CCCC/C=C/CCCCCCCCCc1cccc(OCC(O)CC(C)(C)Oc2ccc(C(C)(C)c3ccc(C(C)(CC)OCC(O)COc4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C55H78O6/c1-8-10-11-12-13-14-15-16-17-18-19-20-22-26-44-27-25-30-52(39-44)59-41-48(56)40-53(3,4)61-51-37-35-46(36-38-51)54(5,6)45-31-33-47(34-32-45)55(7,9-2)60-43-49(57)42-58-50-28-23-21-24-29-50/h12-13,21,23-25,27-39,48-49,56-57H,8-11,14-20,22,26,40-43H2,1-7H3/b13-12+ |
| InChIKey | ASHWBPGZDFJHAS-OUKQBFOZSA-N |
| XLogP | 13.49 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.22 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|