C20H15ClF3N3O — CID 118121331
N-[2-[4-(2-chloro-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 118121331) has the molecular formula C20H15ClF3N3O and a molecular weight of 405.81 g/mol. Its IUPAC name is N-[2-[4-(2-chloro-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-[4-(2-chloro-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118121331 |
| Molecular Formula | C20H15ClF3N3O |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[2-[4-(2-chloro-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(-c2ccnc(Cl)c2)cc1)c1cccnc1C(F)(F)F |
| InChI | InChI=1S/C20H15ClF3N3O/c21-17-12-15(8-11-25-17)14-5-3-13(4-6-14)7-10-27-19(28)16-2-1-9-26-18(16)20(22,23)24/h1-6,8-9,11-12H,7,10H2,(H,27,28) |
| InChIKey | SDVDMTVGJJOOQM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|