C22H23ClN6O2 — CID 11812211
N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(ethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide (PubChem CID 11812211) has the molecular formula C22H23ClN6O2 and a molecular weight of 438.92 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(ethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(ethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 11812211 |
| Molecular Formula | C22H23ClN6O2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(ethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NCC)c2=O)cc1 |
| InChI | InChI=1S/C22H23ClN6O2/c1-2-26-21-22(31)29(18(19(23)28-21)15-6-4-3-5-7-15)13-17(30)27-12-14-8-10-16(11-9-14)20(24)25/h3-11H,2,12-13H2,1H3,(H3,24,25)(H,26,28)(H,27,30) |
| InChIKey | YVHIKFJQHSFNHK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|