C54H45N3O — CID 118123093
(2Z,4E)-1-(3-dibenzofuran-3-yl-4,6-dimethylcyclohexa-1,3-dien-1-yl)-4-[3-[(3,5-diphenyl-1,3-dihydropyrazol-2-yl)methyl]phenyl]-6-methylidene-1-benzazocine (PubChem CID 118123093) has the molecular formula C54H45N3O and a molecular weight of 751.97 g/mol. Its IUPAC name is (2Z,4E)-1-(3-dibenzofuran-3-yl-4,6-dimethylcyclohexa-1,3-dien-1-yl)-4-[3-[(3,5-diphenyl-1,3-dihydropyrazol-2-yl)methyl]phenyl]-6-methylidene-1-benzazocine.
| Compound Name | (2Z,4E)-1-(3-dibenzofuran-3-yl-4,6-dimethylcyclohexa-1,3-dien-1-yl)-4-[3-[(3,5-diphenyl-1,3-dihydropyrazol-2-yl)methyl]phenyl]-6-methylidene-1-benzazocine |
|---|---|
| PubChem CID | 118123093 |
| Molecular Formula | C54H45N3O |
| Molecular Weight | 751.97 g/mol |
| Exact Mass | 751.36 |
| IUPAC Name | (2Z,4E)-1-(3-dibenzofuran-3-yl-4,6-dimethylcyclohexa-1,3-dien-1-yl)-4-[3-[(3,5-diphenyl-1,3-dihydropyrazol-2-yl)methyl]phenyl]-6-methylidene-1-benzazocine |
| SMILES | C=C1/C=C(c2cccc(CN3NC(c4ccccc4)=CC3c3ccccc3)c2)\C=C/N(C2=CC(c3ccc4c(c3)oc3ccccc34)=C(C)CC2C)c2ccccc21 |
| InChI | InChI=1S/C54H45N3O/c1-36-29-38(3)51(33-48(36)44-25-26-47-46-22-11-13-24-53(46)58-54(47)32-44)56-28-27-43(30-37(2)45-21-10-12-23-50(45)56)42-20-14-15-39(31-42)35-57-52(41-18-8-5-9-19-41)34-49(55-57)40-16-6-4-7-17-40/h4-28,30-34,38,52,55H,2,29,35H2,1,3H3/b28-27-,43-30+ |
| InChIKey | WLLCBBDLESOHDG-SQPUHREASA-N |
| XLogP | 13.52 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.97 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |