C7H12F6NO5P — CID 118123540
N-ethyl-3,3,3-trifluoro-N-(2,2,2-trifluoroethyl)propanamide;phosphoric acid (PubChem CID 118123540) has the molecular formula C7H12F6NO5P and a molecular weight of 335.14 g/mol. Its IUPAC name is N-ethyl-3,3,3-trifluoro-N-(2,2,2-trifluoroethyl)propanamide;phosphoric acid.
| Compound Name | N-ethyl-3,3,3-trifluoro-N-(2,2,2-trifluoroethyl)propanamide;phosphoric acid |
|---|---|
| PubChem CID | 118123540 |
| Molecular Formula | C7H12F6NO5P |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-ethyl-3,3,3-trifluoro-N-(2,2,2-trifluoroethyl)propanamide;phosphoric acid |
| SMILES | CCN(CC(F)(F)F)C(=O)CC(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C7H9F6NO.H3O4P/c1-2-14(4-7(11,12)13)5(15)3-6(8,9)10;1-5(2,3)4/h2-4H2,1H3;(H3,1,2,3,4) |
| InChIKey | KHUUORKVBKEAPG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|