About 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione
3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione (PubChem CID 118123840) has the molecular formula C10H19N3S
and a molecular weight of 213.35 g/mol. Its IUPAC name is 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione |
| PubChem CID | 118123840 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione |
| SMILES | CCCCCCCC1N=NC(=S)N1C |
| InChI | InChI=1S/C10H19N3S/c1-3-4-5-6-7-8-9-11-12-10(14)13(9)2/h9H,3-8H2,1-2H3 |
| InChIKey | RJNZDEVKOMDREX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione?
The IUPAC name of 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione (CID 118123840) is 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione.
What is the SMILES notation for 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione?
The canonical SMILES for 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione is CCCCCCCC1N=NC(=S)N1C.
What is the InChIKey of 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione?
The InChIKey is RJNZDEVKOMDREX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3S/c1-3-4-5-6-7-8-9-11-12-10(14)13(9)2/h9H,3-8H2,1-2H3.
What are the key properties of 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione?
3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione has a molecular weight of 213.35 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptyl-4-methyl-3H-1,2,4-triazole-5-thione is sourced from PubChem (CID 118123840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).