C9H17N4NaS — CID 165359856
sodium 1-octyl-1,2,3-triaza-4-azanidacyclopent-2-ene-5-thione (PubChem CID 165359856) has the molecular formula C9H17N4NaS and a molecular weight of 236.32 g/mol. Its IUPAC name is sodium 1-octyl-1,2,3-triaza-4-azanidacyclopent-2-ene-5-thione.
| Compound Name | sodium 1-octyl-1,2,3-triaza-4-azanidacyclopent-2-ene-5-thione |
|---|---|
| PubChem CID | 165359856 |
| Molecular Formula | C9H17N4NaS |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | sodium 1-octyl-1,2,3-triaza-4-azanidacyclopent-2-ene-5-thione |
| SMILES | CCCCCCCCn1nn[n-]c1=S.[Na+] |
| InChI | InChI=1S/C9H18N4S.Na/c1-2-3-4-5-6-7-8-13-9(14)10-11-12-13;/h2-8H2,1H3,(H,10,12,14);/q;+1/p-1 |
| InChIKey | OBVYLUFOGSHEHE-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 44.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|