About sodium;hydride;1-octyl-2H-tetrazole-5-thione
sodium;hydride;1-octyl-2H-tetrazole-5-thione (PubChem CID 173233563) has the molecular formula C9H19N4NaS
and a molecular weight of 238.34 g/mol. Its IUPAC name is sodium;hydride;1-octyl-2H-tetrazole-5-thione.
Molecular Properties
| Compound Name | sodium;hydride;1-octyl-2H-tetrazole-5-thione |
| PubChem CID | 173233563 |
| Molecular Formula | C9H19N4NaS |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | sodium;hydride;1-octyl-2H-tetrazole-5-thione |
| SMILES | CCCCCCCCn1[nH]nnc1=S.[H-].[Na+] |
| InChI | InChI=1S/C9H18N4S.Na.H/c1-2-3-4-5-6-7-8-13-9(14)10-11-12-13;;/h2-8H2,1H3,(H,10,12,14);;/q;+1;-1 |
| InChIKey | FJMKJTSOPNPARP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1-octyl-2H-tetrazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-octyl-2H-tetrazole-5-thione?
The IUPAC name of sodium;hydride;1-octyl-2H-tetrazole-5-thione (CID 173233563) is sodium;hydride;1-octyl-2H-tetrazole-5-thione.
What is the SMILES notation for sodium;hydride;1-octyl-2H-tetrazole-5-thione?
The canonical SMILES for sodium;hydride;1-octyl-2H-tetrazole-5-thione is CCCCCCCCn1[nH]nnc1=S.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-octyl-2H-tetrazole-5-thione?
The InChIKey is FJMKJTSOPNPARP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4S.Na.H/c1-2-3-4-5-6-7-8-13-9(14)10-11-12-13;;/h2-8H2,1H3,(H,10,12,14);;/q;+1;-1.
What are the key properties of sodium;hydride;1-octyl-2H-tetrazole-5-thione?
sodium;hydride;1-octyl-2H-tetrazole-5-thione has a molecular weight of 238.34 g/mol, XLogP of -0.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-octyl-2H-tetrazole-5-thione is sourced from PubChem (CID 173233563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).