C22H28Cl2N3O8PS — CID 118125895
propan-2-yl (2S)-2-[[[(2R,3R,5R)-4,4-dichloro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 118125895) has the molecular formula C22H28Cl2N3O8PS and a molecular weight of 596.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,5R)-4,4-dichloro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,5R)-4,4-dichloro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118125895 |
| Molecular Formula | C22H28Cl2N3O8PS |
| Molecular Weight | 596.43 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,5R)-4,4-dichloro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | Cc1cn([C@@H]2O[C@H](CO[P@@](=S)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)C2(Cl)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28Cl2N3O8PS/c1-12(2)33-19(30)14(4)26-36(37,35-15-8-6-5-7-9-15)32-11-16-17(28)22(23,24)20(34-16)27-10-13(3)18(29)25-21(27)31/h5-10,12,14,16-17,20,28H,11H2,1-4H3,(H,26,37)(H,25,29,31)/t14-,16+,17+,20+,36-/m0/s1 |
| InChIKey | FMTUTVSANMWGJI-KJRCJTOLSA-N |
| XLogP | 2.53 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|