C22H28Cl2N3O8PS — CID 144853937
propan-2-yl (2S)-2-[[[(2R,3R)-4,4-dichloro-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 144853937) has the molecular formula C22H28Cl2N3O8PS and a molecular weight of 596.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R)-4,4-dichloro-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R)-4,4-dichloro-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 144853937 |
| Molecular Formula | C22H28Cl2N3O8PS |
| Molecular Weight | 596.43 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R)-4,4-dichloro-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=S)(OC[C@H]1OC(Cn2ccc(=O)[nH]c2=O)C(Cl)(Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28Cl2N3O8PS/c1-13(2)33-20(30)14(3)26-36(37,35-15-7-5-4-6-8-15)32-12-16-19(29)22(23,24)17(34-16)11-27-10-9-18(28)25-21(27)31/h4-10,13-14,16-17,19,29H,11-12H2,1-3H3,(H,26,37)(H,25,28,31)/t14-,16+,17?,19+,36-/m0/s1 |
| InChIKey | PVNBCSREHONRTH-JBWYZAEESA-N |
| XLogP | 2.09 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|