C23H22N6O — CID 118127429
[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 118127429) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is [2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 118127429 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | C=C1CC(c2nc3cc(C)c(C)cc3[nH]2)N(C(=O)c2ccccc2-n2nccn2)C1 |
| InChI | InChI=1S/C23H22N6O/c1-14-10-21(22-26-18-11-15(2)16(3)12-19(18)27-22)28(13-14)23(30)17-6-4-5-7-20(17)29-24-8-9-25-29/h4-9,11-12,21H,1,10,13H2,2-3H3,(H,26,27) |
| InChIKey | DLVLLKYWAYBERE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|